C23H32N6O2 — CID 53336252
4-amino-N-(4-ethoxyphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine-5-carboxamide (PubChem CID 53336252) has the molecular formula C23H32N6O2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 4-amino-N-(4-ethoxyphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-N-(4-ethoxyphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53336252 |
| Molecular Formula | C23H32N6O2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-amino-N-(4-ethoxyphenyl)-2-(4-piperidin-1-ylpiperidin-1-yl)pyrimidine-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cnc(N3CCC(N4CCCCC4)CC3)nc2N)cc1 |
| InChI | InChI=1S/C23H32N6O2/c1-2-31-19-8-6-17(7-9-19)26-22(30)20-16-25-23(27-21(20)24)29-14-10-18(11-15-29)28-12-4-3-5-13-28/h6-9,16,18H,2-5,10-15H2,1H3,(H,26,30)(H2,24,25,27) |
| InChIKey | YKQYUUVMBOYQKE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |