C17H21N5O2S — CID 53144022
4-amino-N-(4-ethoxyphenyl)-2-thiomorpholin-4-ylpyrimidine-5-carboxamide (PubChem CID 53144022) has the molecular formula C17H21N5O2S and a molecular weight of 359.46 g/mol. Its IUPAC name is 4-amino-N-(4-ethoxyphenyl)-2-thiomorpholin-4-ylpyrimidine-5-carboxamide.
| Compound Name | 4-amino-N-(4-ethoxyphenyl)-2-thiomorpholin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53144022 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-amino-N-(4-ethoxyphenyl)-2-thiomorpholin-4-ylpyrimidine-5-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cnc(N3CCSCC3)nc2N)cc1 |
| InChI | InChI=1S/C17H21N5O2S/c1-2-24-13-5-3-12(4-6-13)20-16(23)14-11-19-17(21-15(14)18)22-7-9-25-10-8-22/h3-6,11H,2,7-10H2,1H3,(H,20,23)(H2,18,19,21) |
| InChIKey | HPCFIFSYMIKCEP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |