C29H34N4O2S — CID 87909181
O-[4-[3-[[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinolin-6-yl]amino]-3-oxopropyl]phenyl] methanethioate (PubChem CID 87909181) has the molecular formula C29H34N4O2S and a molecular weight of 502.68 g/mol. Its IUPAC name is O-[4-[3-[[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinolin-6-yl]amino]-3-oxopropyl]phenyl] methanethioate.
| Compound Name | O-[4-[3-[[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinolin-6-yl]amino]-3-oxopropyl]phenyl] methanethioate |
|---|---|
| PubChem CID | 87909181 |
| Molecular Formula | C29H34N4O2S |
| Molecular Weight | 502.68 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | O-[4-[3-[[4-methyl-2-(4-pyrrolidin-1-ylpiperidin-1-yl)quinolin-6-yl]amino]-3-oxopropyl]phenyl] methanethioate |
| SMILES | Cc1cc(N2CCC(N3CCCC3)CC2)nc2ccc(NC(=O)CCc3ccc(OC=S)cc3)cc12 |
| InChI | InChI=1S/C29H34N4O2S/c1-21-18-28(33-16-12-24(13-17-33)32-14-2-3-15-32)31-27-10-7-23(19-26(21)27)30-29(34)11-6-22-4-8-25(9-5-22)35-20-36/h4-5,7-10,18-20,24H,2-3,6,11-17H2,1H3,(H,30,34) |
| InChIKey | LNSHLINXKQDIPZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|