C24H28N4S — CID 6621736
1-[(4-ethylphenyl)methyl]-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea (PubChem CID 6621736) has the molecular formula C24H28N4S and a molecular weight of 404.58 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea.
| Compound Name | 1-[(4-ethylphenyl)methyl]-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea |
|---|---|
| PubChem CID | 6621736 |
| Molecular Formula | C24H28N4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea |
| SMILES | CCc1ccc(CNC(=S)Nc2ccc3nc(N4CCCC4)cc(C)c3c2)cc1 |
| InChI | InChI=1S/C24H28N4S/c1-3-18-6-8-19(9-7-18)16-25-24(29)26-20-10-11-22-21(15-20)17(2)14-23(27-22)28-12-4-5-13-28/h6-11,14-15H,3-5,12-13,16H2,1-2H3,(H2,25,26,29) |
| InChIKey | DBJUVNBQIXUBRJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|