C20H22N4OS — CID 46251268
1-(furan-2-ylmethyl)-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea (PubChem CID 46251268) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea |
|---|---|
| PubChem CID | 46251268 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)thiourea |
| SMILES | Cc1cc(N2CCCC2)nc2ccc(NC(=S)NCc3ccco3)cc12 |
| InChI | InChI=1S/C20H22N4OS/c1-14-11-19(24-8-2-3-9-24)23-18-7-6-15(12-17(14)18)22-20(26)21-13-16-5-4-10-25-16/h4-7,10-12H,2-3,8-9,13H2,1H3,(H2,21,22,26) |
| InChIKey | UUTKCWHTKQGAEH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 53.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|