C18H24N4O2S — CID 4195707
1-(2-methoxyethyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)thiourea (PubChem CID 4195707) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)thiourea |
|---|---|
| PubChem CID | 4195707 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)thiourea |
| SMILES | COCCNC(=S)Nc1ccc2nc(N3CCOCC3)cc(C)c2c1 |
| InChI | InChI=1S/C18H24N4O2S/c1-13-11-17(22-6-9-24-10-7-22)21-16-4-3-14(12-15(13)16)20-18(25)19-5-8-23-2/h3-4,11-12H,5-10H2,1-2H3,(H2,19,20,25) |
| InChIKey | ZALWHJRJBOFHFH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|