C22H31N5O3 — CID 22426968
N-[2-(dimethylamino)ethyl]-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide (PubChem CID 22426968) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 22426968 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide |
| SMILES | Cc1cc(N2CCOCC2)nc2ccc(NC(=O)CCC(=O)NCCN(C)C)cc12 |
| InChI | InChI=1S/C22H31N5O3/c1-16-14-20(27-10-12-30-13-11-27)25-19-5-4-17(15-18(16)19)24-22(29)7-6-21(28)23-8-9-26(2)3/h4-5,14-15H,6-13H2,1-3H3,(H,23,28)(H,24,29) |
| InChIKey | POSGEWUKBZICGB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |