C29H44N6O2 — CID 22334469
N'-(4-methyl-2-piperidin-1-ylquinolin-6-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]butanediamide (PubChem CID 22334469) has the molecular formula C29H44N6O2 and a molecular weight of 508.71 g/mol. Its IUPAC name is N'-(4-methyl-2-piperidin-1-ylquinolin-6-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]butanediamide.
| Compound Name | N'-(4-methyl-2-piperidin-1-ylquinolin-6-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]butanediamide |
|---|---|
| PubChem CID | 22334469 |
| Molecular Formula | C29H44N6O2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | N'-(4-methyl-2-piperidin-1-ylquinolin-6-yl)-N-[3-(4-propylpiperazin-1-yl)propyl]butanediamide |
| SMILES | CCCN1CCN(CCCNC(=O)CCC(=O)Nc2ccc3nc(N4CCCCC4)cc(C)c3c2)CC1 |
| InChI | InChI=1S/C29H44N6O2/c1-3-13-33-17-19-34(20-18-33)14-7-12-30-28(36)10-11-29(37)31-24-8-9-26-25(22-24)23(2)21-27(32-26)35-15-5-4-6-16-35/h8-9,21-22H,3-7,10-20H2,1-2H3,(H,30,36)(H,31,37) |
| InChIKey | KXGBIEVMLZCAAC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|