C28H41N5O3 — CID 22427825
N'-[2-(3,5-dimethylpiperidin-1-yl)-4-methylquinolin-6-yl]-N-(3-morpholin-4-ylpropyl)butanediamide (PubChem CID 22427825) has the molecular formula C28H41N5O3 and a molecular weight of 495.67 g/mol. Its IUPAC name is N'-[2-(3,5-dimethylpiperidin-1-yl)-4-methylquinolin-6-yl]-N-(3-morpholin-4-ylpropyl)butanediamide.
| Compound Name | N'-[2-(3,5-dimethylpiperidin-1-yl)-4-methylquinolin-6-yl]-N-(3-morpholin-4-ylpropyl)butanediamide |
|---|---|
| PubChem CID | 22427825 |
| Molecular Formula | C28H41N5O3 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | N'-[2-(3,5-dimethylpiperidin-1-yl)-4-methylquinolin-6-yl]-N-(3-morpholin-4-ylpropyl)butanediamide |
| SMILES | Cc1cc(N2CC(C)CC(C)C2)nc2ccc(NC(=O)CCC(=O)NCCCN3CCOCC3)cc12 |
| InChI | InChI=1S/C28H41N5O3/c1-20-15-21(2)19-33(18-20)26-16-22(3)24-17-23(5-6-25(24)31-26)30-28(35)8-7-27(34)29-9-4-10-32-11-13-36-14-12-32/h5-6,16-17,20-21H,4,7-15,18-19H2,1-3H3,(H,29,34)(H,30,35) |
| InChIKey | KWANIVQBIARZKT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|