C26H40N6S — CID 92656187
1-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea (PubChem CID 92656187) has the molecular formula C26H40N6S and a molecular weight of 468.72 g/mol. Its IUPAC name is 1-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea.
| Compound Name | 1-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 92656187 |
| Molecular Formula | C26H40N6S |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 1-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea |
| SMILES | Cc1cc(N2CCN(C)CC2)nc2ccc(NC(=S)NCCCN3C[C@@H](C)C[C@H](C)C3)cc12 |
| InChI | InChI=1S/C26H40N6S/c1-19-14-20(2)18-31(17-19)9-5-8-27-26(33)28-22-6-7-24-23(16-22)21(3)15-25(29-24)32-12-10-30(4)11-13-32/h6-7,15-16,19-20H,5,8-14,17-18H2,1-4H3,(H2,27,28,33)/t19-,20-/m0/s1 |
| InChIKey | KZQKJXVUTGQWIZ-PMACEKPBSA-N |
| XLogP | 3.95 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|