C26H40N6S — CID 46247970
1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 46247970) has the molecular formula C26H40N6S and a molecular weight of 468.72 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 46247970 |
| Molecular Formula | C26H40N6S |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[3-(4-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)NCCCN4CCC(C)CC4)ccc3n2)CC1 |
| InChI | InChI=1S/C26H40N6S/c1-4-30-14-16-32(17-15-30)25-18-21(3)23-19-22(6-7-24(23)29-25)28-26(33)27-10-5-11-31-12-8-20(2)9-13-31/h6-7,18-20H,4-5,8-17H2,1-3H3,(H2,27,28,33) |
| InChIKey | JTPPAYCBSRPEQV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|