C27H33N5S — CID 92656169
1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea (PubChem CID 92656169) has the molecular formula C27H33N5S and a molecular weight of 459.66 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
|---|---|
| PubChem CID | 92656169 |
| Molecular Formula | C27H33N5S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]thiourea |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)N[C@H]4CCCc5ccccc54)ccc3n2)CC1 |
| InChI | InChI=1S/C27H33N5S/c1-3-31-13-15-32(16-14-31)26-17-19(2)23-18-21(11-12-25(23)29-26)28-27(33)30-24-10-6-8-20-7-4-5-9-22(20)24/h4-5,7,9,11-12,17-18,24H,3,6,8,10,13-16H2,1-2H3,(H2,28,30,33)/t24-/m0/s1 |
| InChIKey | HBUMPMJNLBRUCT-DEOSSOPVSA-N |
| XLogP | 5.05 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|