C31H42N6S — CID 46247988
1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]thiourea (PubChem CID 46247988) has the molecular formula C31H42N6S and a molecular weight of 530.79 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]thiourea.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]thiourea |
|---|---|
| PubChem CID | 46247988 |
| Molecular Formula | C31H42N6S |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-3-[[1-[(3-methylphenyl)methyl]piperidin-4-yl]methyl]thiourea |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)NCC4CCN(Cc5cccc(C)c5)CC4)ccc3n2)CC1 |
| InChI | InChI=1S/C31H42N6S/c1-4-35-14-16-37(17-15-35)30-19-24(3)28-20-27(8-9-29(28)34-30)33-31(38)32-21-25-10-12-36(13-11-25)22-26-7-5-6-23(2)18-26/h5-9,18-20,25H,4,10-17,21-22H2,1-3H3,(H2,32,33,38) |
| InChIKey | FYRVCCOWZIOWDV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|