C24H36N6O2S — CID 156719560
tert-butyl N-[2-[[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]carbamothioylamino]ethyl]carbamate (PubChem CID 156719560) has the molecular formula C24H36N6O2S and a molecular weight of 472.66 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]carbamothioylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]carbamothioylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 156719560 |
| Molecular Formula | C24H36N6O2S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | tert-butyl N-[2-[[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]carbamothioylamino]ethyl]carbamate |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)NCCNC(=O)OC(C)(C)C)ccc3n2)CC1 |
| InChI | InChI=1S/C24H36N6O2S/c1-6-29-11-13-30(14-12-29)21-15-17(2)19-16-18(7-8-20(19)28-21)27-22(33)25-9-10-26-23(31)32-24(3,4)5/h7-8,15-16H,6,9-14H2,1-5H3,(H,26,31)(H2,25,27,33) |
| InChIKey | HLIBCEAFKRSKEO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|