C27H34N4O — CID 44522357
4-tert-butyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]benzamide (PubChem CID 44522357) has the molecular formula C27H34N4O and a molecular weight of 430.60 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 44522357 |
| Molecular Formula | C27H34N4O |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 4-tert-butyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]benzamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)c4ccc(C(C)(C)C)cc4)ccc3n2)CC1 |
| InChI | InChI=1S/C27H34N4O/c1-6-30-13-15-31(16-14-30)25-17-19(2)23-18-22(11-12-24(23)29-25)28-26(32)20-7-9-21(10-8-20)27(3,4)5/h7-12,17-18H,6,13-16H2,1-5H3,(H,28,32) |
| InChIKey | CAVCTOGSRWVGJI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |