C25H27ClN4O — CID 45488246
(E)-3-(2-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]prop-2-enamide (PubChem CID 45488246) has the molecular formula C25H27ClN4O and a molecular weight of 434.97 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 45488246 |
| Molecular Formula | C25H27ClN4O |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]prop-2-enamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)/C=C/c4ccccc4Cl)ccc3n2)CC1 |
| InChI | InChI=1S/C25H27ClN4O/c1-3-29-12-14-30(15-13-29)24-16-18(2)21-17-20(9-10-23(21)28-24)27-25(31)11-8-19-6-4-5-7-22(19)26/h4-11,16-17H,3,12-15H2,1-2H3,(H,27,31)/b11-8+ |
| InChIKey | JTPVKCHYAFRZLA-DHZHZOJOSA-N |
| XLogP | 4.99 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|