C26H29N3O3 — CID 3490612
3-(2,3-dimethoxyphenyl)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)prop-2-enamide (PubChem CID 3490612) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)prop-2-enamide.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3490612 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)Nc2ccc3nc(N4CCCCC4)cc(C)c3c2)c1OC |
| InChI | InChI=1S/C26H29N3O3/c1-18-16-24(29-14-5-4-6-15-29)28-22-12-11-20(17-21(18)22)27-25(30)13-10-19-8-7-9-23(31-2)26(19)32-3/h7-13,16-17H,4-6,14-15H2,1-3H3,(H,27,30) |
| InChIKey | RLBOANYLNSXPKA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|