C31H32ClN3O4 — CID 146051436
(E)-3-(2,3-dimethoxyphenyl)-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide;hydrochloride (PubChem CID 146051436) has the molecular formula C31H32ClN3O4 and a molecular weight of 546.07 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide;hydrochloride.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 146051436 |
| Molecular Formula | C31H32ClN3O4 |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide;hydrochloride |
| SMILES | COc1ccccc1Nc1c2c(nc3ccc(NC(=O)/C=C/c4cccc(OC)c4OC)cc13)CCCC2.Cl |
| InChI | InChI=1S/C31H31N3O4.ClH/c1-36-27-13-7-6-12-26(27)34-30-22-10-4-5-11-24(22)33-25-17-16-21(19-23(25)30)32-29(35)18-15-20-9-8-14-28(37-2)31(20)38-3;/h6-9,12-19H,4-5,10-11H2,1-3H3,(H,32,35)(H,33,34);1H/b18-15+; |
| InChIKey | LWXPLRAEEQQPJO-FLNCGGNMSA-N |
| XLogP | 6.96 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|