C27H24ClFN4O4 — CID 146051491
4-fluoro-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 146051491) has the molecular formula C27H24ClFN4O4 and a molecular weight of 522.96 g/mol. Its IUPAC name is 4-fluoro-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-fluoro-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 146051491 |
| Molecular Formula | C27H24ClFN4O4 |
| Molecular Weight | 522.96 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 4-fluoro-N-[9-(2-methoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | COc1ccccc1Nc1c2c(nc3ccc(NC(=O)c4ccc(F)c([N+](=O)[O-])c4)cc13)CCCC2.Cl |
| InChI | InChI=1S/C27H23FN4O4.ClH/c1-36-25-9-5-4-8-23(25)31-26-18-6-2-3-7-21(18)30-22-13-11-17(15-19(22)26)29-27(33)16-10-12-20(28)24(14-16)32(34)35;/h4-5,8-15H,2-3,6-7H2,1H3,(H,29,33)(H,30,31);1H |
| InChIKey | QAKKXEYEORAZAE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.96 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|