C29H28N4O6 — CID 46503451
N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-4-methoxy-3-nitrobenzamide (PubChem CID 46503451) has the molecular formula C29H28N4O6 and a molecular weight of 528.57 g/mol. Its IUPAC name is N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 46503451 |
| Molecular Formula | C29H28N4O6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(Nc2c3c(nc4ccc(NC(=O)c5ccc(OC)c([N+](=O)[O-])c5)cc24)CCCC3)cc1OC |
| InChI | InChI=1S/C29H28N4O6/c1-37-25-12-8-17(14-24(25)33(35)36)29(34)31-18-9-11-23-21(15-18)28(20-6-4-5-7-22(20)32-23)30-19-10-13-26(38-2)27(16-19)39-3/h8-16H,4-7H2,1-3H3,(H,30,32)(H,31,34) |
| InChIKey | SMVHNGGOEJKOHW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|