C29H29N3O3S — CID 6058396
(E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide (PubChem CID 6058396) has the molecular formula C29H29N3O3S and a molecular weight of 499.64 g/mol. Its IUPAC name is (E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6058396 |
| Molecular Formula | C29H29N3O3S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | (E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(3-methylthiophen-2-yl)prop-2-enamide |
| SMILES | COc1ccc(Nc2c3c(nc4ccc(NC(=O)/C=C/c5sccc5C)cc24)CCCC3)cc1OC |
| InChI | InChI=1S/C29H29N3O3S/c1-18-14-15-36-27(18)12-13-28(33)30-19-8-10-24-22(16-19)29(21-6-4-5-7-23(21)32-24)31-20-9-11-25(34-2)26(17-20)35-3/h8-17H,4-7H2,1-3H3,(H,30,33)(H,31,32)/b13-12+ |
| InChIKey | ICKOCZXJBPOJBD-OUKQBFOZSA-N |
| XLogP | 6.90 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|