C21H21ClN2O2 — CID 20859027
6-chloro-N-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 20859027) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 6-chloro-N-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 6-chloro-N-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 20859027 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-chloro-N-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | COc1ccc(Nc2c3c(nc4cc(Cl)ccc24)CCCC3)cc1OC |
| InChI | InChI=1S/C21H21ClN2O2/c1-25-19-10-8-14(12-20(19)26-2)23-21-15-5-3-4-6-17(15)24-18-11-13(22)7-9-16(18)21/h7-12H,3-6H2,1-2H3,(H,23,24) |
| InChIKey | WPVUYOUEZBWHNY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |