About N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride
N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride (PubChem CID 2790059) has the molecular formula C18H16Cl2N2
and a molecular weight of 331.25 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride |
| PubChem CID | 2790059 |
| Molecular Formula | C18H16Cl2N2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(Nc2c3c(nc4ccccc24)CCC3)cc1 |
| InChI | InChI=1S/C18H15ClN2.ClH/c19-12-8-10-13(11-9-12)20-18-14-4-1-2-6-16(14)21-17-7-3-5-15(17)18;/h1-2,4,6,8-11H,3,5,7H2,(H,20,21);1H |
| InChIKey | LVXGHCHVKBSSLE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
The IUPAC name of N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride (CID 2790059) is N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride.
What is the SMILES notation for N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
The canonical SMILES for N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride is Cl.Clc1ccc(Nc2c3c(nc4ccccc24)CCC3)cc1.
What is the InChIKey of N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
The InChIKey is LVXGHCHVKBSSLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClN2.ClH/c19-12-8-10-13(11-9-12)20-18-14-4-1-2-6-16(14)21-17-7-3-5-15(17)18;/h1-2,4,6,8-11H,3,5,7H2,(H,20,21);1H.
What are the key properties of N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride?
N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride has a molecular weight of 331.25 g/mol, XLogP of 5.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride is sourced from PubChem (CID 2790059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).