C19H16ClFN2 — CID 3658778
N-(3-chloro-4-fluorophenyl)-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 3658778) has the molecular formula C19H16ClFN2 and a molecular weight of 326.80 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 3658778 |
| Molecular Formula | C19H16ClFN2 |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Fc1ccc(Nc2c3c(nc4ccccc24)CCCC3)cc1Cl |
| InChI | InChI=1S/C19H16ClFN2/c20-15-11-12(9-10-16(15)21)22-19-13-5-1-3-7-17(13)23-18-8-4-2-6-14(18)19/h1,3,5,7,9-11H,2,4,6,8H2,(H,22,23) |
| InChIKey | KOGABTAOZMLNIH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |