C30H28ClN3O3 — CID 6004990
(E)-3-(3-chlorophenyl)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide (PubChem CID 6004990) has the molecular formula C30H28ClN3O3 and a molecular weight of 514.03 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6004990 |
| Molecular Formula | C30H28ClN3O3 |
| Molecular Weight | 514.03 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]prop-2-enamide |
| SMILES | COc1ccc(Nc2c3c(nc4ccc(NC(=O)/C=C/c5cccc(Cl)c5)cc24)CCCC3)cc1OC |
| InChI | InChI=1S/C30H28ClN3O3/c1-36-27-14-12-22(18-28(27)37-2)33-30-23-8-3-4-9-25(23)34-26-13-11-21(17-24(26)30)32-29(35)15-10-19-6-5-7-20(31)16-19/h5-7,10-18H,3-4,8-9H2,1-2H3,(H,32,35)(H,33,34)/b15-10+ |
| InChIKey | XXSMSUUHFUGZPL-XNTDXEJSSA-N |
| XLogP | 7.18 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.03 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|