C32H33N3O4 — CID 6056204
(E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 6056204) has the molecular formula C32H33N3O4 and a molecular weight of 523.63 g/mol. Its IUPAC name is (E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6056204 |
| Molecular Formula | C32H33N3O4 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | (E)-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)Nc1ccc2nc3c(c(Nc4ccc(OC)c(OC)c4)c2c1)CCCC3 |
| InChI | InChI=1S/C32H33N3O4/c1-4-39-28-12-8-5-9-21(28)13-18-31(36)33-22-14-16-27-25(19-22)32(24-10-6-7-11-26(24)35-27)34-23-15-17-29(37-2)30(20-23)38-3/h5,8-9,12-20H,4,6-7,10-11H2,1-3H3,(H,33,36)(H,34,35)/b18-13+ |
| InChIKey | YONKRFRIMOQNQU-QGOAFFKASA-N |
| XLogP | 6.93 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|