C28H26ClN3O3 — CID 46257075
2-chloro-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]benzamide (PubChem CID 46257075) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is 2-chloro-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]benzamide.
| Compound Name | 2-chloro-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]benzamide |
|---|---|
| PubChem CID | 46257075 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 2-chloro-N-[9-(3,4-dimethoxyanilino)-5,6,7,8-tetrahydroacridin-2-yl]benzamide |
| SMILES | COc1ccc(Nc2c3c(nc4ccc(NC(=O)c5ccccc5Cl)cc24)CCCC3)cc1OC |
| InChI | InChI=1S/C28H26ClN3O3/c1-34-25-14-12-18(16-26(25)35-2)30-27-20-8-4-6-10-23(20)32-24-13-11-17(15-21(24)27)31-28(33)19-7-3-5-9-22(19)29/h3,5,7,9,11-16H,4,6,8,10H2,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | YQTFGBNNSDVSOL-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |