C21H24N2O3 — CID 5239068
N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-3,4-dimethoxybenzamide (PubChem CID 5239068) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 5239068 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-(2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c3c(nc4c2CCC4)CCCC3)cc1OC |
| InChI | InChI=1S/C21H24N2O3/c1-25-18-11-10-13(12-19(18)26-2)21(24)23-20-14-6-3-4-8-16(14)22-17-9-5-7-15(17)20/h10-12H,3-9H2,1-2H3,(H,22,23,24) |
| InChIKey | LAIREDMTDUWRAS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |