C29H30N6O3 — CID 4244682
3-(2,3-dimethoxyphenyl)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]prop-2-enamide (PubChem CID 4244682) has the molecular formula C29H30N6O3 and a molecular weight of 510.60 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]prop-2-enamide.
| Compound Name | 3-(2,3-dimethoxyphenyl)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4244682 |
| Molecular Formula | C29H30N6O3 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]prop-2-enamide |
| SMILES | COc1cccc(C=CC(=O)Nc2ccc3nc(N4CCN(c5ncccn5)CC4)cc(C)c3c2)c1OC |
| InChI | InChI=1S/C29H30N6O3/c1-20-18-26(34-14-16-35(17-15-34)29-30-12-5-13-31-29)33-24-10-9-22(19-23(20)24)32-27(36)11-8-21-6-4-7-25(37-2)28(21)38-3/h4-13,18-19H,14-17H2,1-3H3,(H,32,36) |
| InChIKey | YVUCIOUBAJZJAO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|