C19H17N3O4 — CID 136696075
(Z)-3-(2,3-dimethoxyphenyl)-N-(4-oxo-3H-quinazolin-6-yl)prop-2-enamide (PubChem CID 136696075) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (Z)-3-(2,3-dimethoxyphenyl)-N-(4-oxo-3H-quinazolin-6-yl)prop-2-enamide.
| Compound Name | (Z)-3-(2,3-dimethoxyphenyl)-N-(4-oxo-3H-quinazolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 136696075 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (Z)-3-(2,3-dimethoxyphenyl)-N-(4-oxo-3H-quinazolin-6-yl)prop-2-enamide |
| SMILES | COc1cccc(/C=C\C(=O)Nc2ccc3nc[nH]c(=O)c3c2)c1OC |
| InChI | InChI=1S/C19H17N3O4/c1-25-16-5-3-4-12(18(16)26-2)6-9-17(23)22-13-7-8-15-14(10-13)19(24)21-11-20-15/h3-11H,1-2H3,(H,22,23)(H,20,21,24)/b9-6- |
| InChIKey | XJTIPVMNUWOKKA-TWGQIWQCSA-N |
| XLogP | 2.59 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|