C30H32N6O2 — CID 6047140
(E)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-(2-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 6047140) has the molecular formula C30H32N6O2 and a molecular weight of 508.63 g/mol. Its IUPAC name is (E)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-(2-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-(2-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6047140 |
| Molecular Formula | C30H32N6O2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | (E)-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-(2-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(N2CCN(c3ncccn3)CC2)nc2ccc(NC(=O)/C=C/c3ccccc3OC(C)C)cc12 |
| InChI | InChI=1S/C30H32N6O2/c1-21(2)38-27-8-5-4-7-23(27)9-12-29(37)33-24-10-11-26-25(20-24)22(3)19-28(34-26)35-15-17-36(18-16-35)30-31-13-6-14-32-30/h4-14,19-21H,15-18H2,1-3H3,(H,33,37)/b12-9+ |
| InChIKey | XNBNYWSXBWNQEZ-FMIVXFBMSA-N |
| XLogP | 5.10 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|