C23H22BrN3O2 — CID 3266592
3-(4-bromophenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)prop-2-enamide (PubChem CID 3266592) has the molecular formula C23H22BrN3O2 and a molecular weight of 452.35 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)prop-2-enamide.
| Compound Name | 3-(4-bromophenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3266592 |
| Molecular Formula | C23H22BrN3O2 |
| Molecular Weight | 452.35 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-(4-bromophenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)prop-2-enamide |
| SMILES | Cc1cc(N2CCOCC2)nc2ccc(NC(=O)C=Cc3ccc(Br)cc3)cc12 |
| InChI | InChI=1S/C23H22BrN3O2/c1-16-14-22(27-10-12-29-13-11-27)26-21-8-7-19(15-20(16)21)25-23(28)9-4-17-2-5-18(24)6-3-17/h2-9,14-15H,10-13H2,1H3,(H,25,28) |
| InChIKey | UJFNBDWHOASAAU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|