C23H20F3N3O2 — CID 10216600
(E)-N-(2-morpholin-4-ylquinolin-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 10216600) has the molecular formula C23H20F3N3O2 and a molecular weight of 427.43 g/mol. Its IUPAC name is (E)-N-(2-morpholin-4-ylquinolin-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2-morpholin-4-ylquinolin-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 10216600 |
| Molecular Formula | C23H20F3N3O2 |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (E)-N-(2-morpholin-4-ylquinolin-6-yl)-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)Nc1ccc2nc(N3CCOCC3)ccc2c1 |
| InChI | InChI=1S/C23H20F3N3O2/c24-23(25,26)18-5-1-16(2-6-18)3-10-22(30)27-19-7-8-20-17(15-19)4-9-21(28-20)29-11-13-31-14-12-29/h1-10,15H,11-14H2,(H,27,30)/b10-3+ |
| InChIKey | SEBSZXYZIWHPMW-XCVCLJGOSA-N |
| XLogP | 4.74 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|