C20H27N3O2 — CID 46364051
2-ethyl-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanamide (PubChem CID 46364051) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-ethyl-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanamide.
| Compound Name | 2-ethyl-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanamide |
|---|---|
| PubChem CID | 46364051 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-ethyl-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc2nc(N3CCOCC3)cc(C)c2c1 |
| InChI | InChI=1S/C20H27N3O2/c1-4-15(5-2)20(24)21-16-6-7-18-17(13-16)14(3)12-19(22-18)23-8-10-25-11-9-23/h6-7,12-13,15H,4-5,8-11H2,1-3H3,(H,21,24) |
| InChIKey | ULZNPCWELTZMPM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |