C26H31N3O4 — CID 46364061
2-(2,3-diethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)acetamide (PubChem CID 46364061) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-(2,3-diethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)acetamide.
| Compound Name | 2-(2,3-diethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 46364061 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 2-(2,3-diethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)acetamide |
| SMILES | CCOc1cccc(CC(=O)Nc2ccc3nc(N4CCOCC4)cc(C)c3c2)c1OCC |
| InChI | InChI=1S/C26H31N3O4/c1-4-32-23-8-6-7-19(26(23)33-5-2)16-25(30)27-20-9-10-22-21(17-20)18(3)15-24(28-22)29-11-13-31-14-12-29/h6-10,15,17H,4-5,11-14,16H2,1-3H3,(H,27,30) |
| InChIKey | VNSZSYNABHTYJZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |