C26H30N4O4 — CID 22426976
N'-(2-ethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide (PubChem CID 22426976) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N'-(2-ethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide.
| Compound Name | N'-(2-ethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 22426976 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N'-(2-ethoxyphenyl)-N-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide |
| SMILES | CCOc1ccccc1NC(=O)CCC(=O)Nc1ccc2nc(N3CCOCC3)cc(C)c2c1 |
| InChI | InChI=1S/C26H30N4O4/c1-3-34-23-7-5-4-6-22(23)29-26(32)11-10-25(31)27-19-8-9-21-20(17-19)18(2)16-24(28-21)30-12-14-33-15-13-30/h4-9,16-17H,3,10-15H2,1-2H3,(H,27,31)(H,29,32) |
| InChIKey | FKNXYPURUUTCKL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |