C23H32N4O3 — CID 22426993
N-(3-methylbutyl)-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide (PubChem CID 22426993) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-(3-methylbutyl)-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide.
| Compound Name | N-(3-methylbutyl)-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 22426993 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-(3-methylbutyl)-N'-(4-methyl-2-morpholin-4-ylquinolin-6-yl)butanediamide |
| SMILES | Cc1cc(N2CCOCC2)nc2ccc(NC(=O)CCC(=O)NCCC(C)C)cc12 |
| InChI | InChI=1S/C23H32N4O3/c1-16(2)8-9-24-22(28)6-7-23(29)25-18-4-5-20-19(15-18)17(3)14-21(26-20)27-10-12-30-13-11-27/h4-5,14-16H,6-13H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | JLCQDWQUTJWILS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |