C22H23FN4O2 — CID 46288477
1-(3-fluoro-4-methylphenyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)urea (PubChem CID 46288477) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)urea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 46288477 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-(4-methyl-2-morpholin-4-ylquinolin-6-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3nc(N4CCOCC4)cc(C)c3c2)cc1F |
| InChI | InChI=1S/C22H23FN4O2/c1-14-3-4-17(13-19(14)23)25-22(28)24-16-5-6-20-18(12-16)15(2)11-21(26-20)27-7-9-29-10-8-27/h3-6,11-13H,7-10H2,1-2H3,(H2,24,25,28) |
| InChIKey | WKSBYTCDYIMVGY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |