C22H24BrN5O — CID 46280031
1-(4-bromophenyl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]urea (PubChem CID 46280031) has the molecular formula C22H24BrN5O and a molecular weight of 454.37 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]urea |
|---|---|
| PubChem CID | 46280031 |
| Molecular Formula | C22H24BrN5O |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 1-(4-bromophenyl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]urea |
| SMILES | Cc1cc(N2CCN(C)CC2)nc2ccc(NC(=O)Nc3ccc(Br)cc3)cc12 |
| InChI | InChI=1S/C22H24BrN5O/c1-15-13-21(28-11-9-27(2)10-12-28)26-20-8-7-18(14-19(15)20)25-22(29)24-17-5-3-16(23)4-6-17/h3-8,13-14H,9-12H2,1-2H3,(H2,24,25,29) |
| InChIKey | ZANIPQLQIJRQIW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |