C22H23BrN4O — CID 46288414
1-(3-bromophenyl)-3-(4-methyl-2-piperidin-1-ylquinolin-6-yl)urea (PubChem CID 46288414) has the molecular formula C22H23BrN4O and a molecular weight of 439.36 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(4-methyl-2-piperidin-1-ylquinolin-6-yl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(4-methyl-2-piperidin-1-ylquinolin-6-yl)urea |
|---|---|
| PubChem CID | 46288414 |
| Molecular Formula | C22H23BrN4O |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-(3-bromophenyl)-3-(4-methyl-2-piperidin-1-ylquinolin-6-yl)urea |
| SMILES | Cc1cc(N2CCCCC2)nc2ccc(NC(=O)Nc3cccc(Br)c3)cc12 |
| InChI | InChI=1S/C22H23BrN4O/c1-15-12-21(27-10-3-2-4-11-27)26-20-9-8-18(14-19(15)20)25-22(28)24-17-7-5-6-16(23)13-17/h5-9,12-14H,2-4,10-11H2,1H3,(H2,24,25,28) |
| InChIKey | BSKJAAQIOMNRCV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |