C28H28N6O — CID 46504488
(Z)-2-methyl-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-phenylprop-2-enamide (PubChem CID 46504488) has the molecular formula C28H28N6O and a molecular weight of 464.57 g/mol. Its IUPAC name is (Z)-2-methyl-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-2-methyl-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 46504488 |
| Molecular Formula | C28H28N6O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (Z)-2-methyl-N-[4-methyl-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinolin-6-yl]-3-phenylprop-2-enamide |
| SMILES | C/C(=C/c1ccccc1)C(=O)Nc1ccc2nc(N3CCN(c4ncccn4)CC3)cc(C)c2c1 |
| InChI | InChI=1S/C28H28N6O/c1-20-18-26(33-13-15-34(16-14-33)28-29-11-6-12-30-28)32-25-10-9-23(19-24(20)25)31-27(35)21(2)17-22-7-4-3-5-8-22/h3-12,17-19H,13-16H2,1-2H3,(H,31,35)/b21-17- |
| InChIKey | UXNQTEWZDQWTFU-FXBPSFAMSA-N |
| XLogP | 4.70 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|