C26H31N5OS — CID 46251263
4-(2-methoxyphenyl)-N-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)piperazine-1-carbothioamide (PubChem CID 46251263) has the molecular formula C26H31N5OS and a molecular weight of 461.64 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-N-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)piperazine-1-carbothioamide.
| Compound Name | 4-(2-methoxyphenyl)-N-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 46251263 |
| Molecular Formula | C26H31N5OS |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-(2-methoxyphenyl)-N-(4-methyl-2-pyrrolidin-1-ylquinolin-6-yl)piperazine-1-carbothioamide |
| SMILES | COc1ccccc1N1CCN(C(=S)Nc2ccc3nc(N4CCCC4)cc(C)c3c2)CC1 |
| InChI | InChI=1S/C26H31N5OS/c1-19-17-25(30-11-5-6-12-30)28-22-10-9-20(18-21(19)22)27-26(33)31-15-13-29(14-16-31)23-7-3-4-8-24(23)32-2/h3-4,7-10,17-18H,5-6,11-16H2,1-2H3,(H,27,33) |
| InChIKey | SGKPPXOTRBSKKG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 43.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|