C28H35ClN6S — CID 46247979
4-(5-chloro-2-methylphenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]piperazine-1-carbothioamide (PubChem CID 46247979) has the molecular formula C28H35ClN6S and a molecular weight of 523.15 g/mol. Its IUPAC name is 4-(5-chloro-2-methylphenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]piperazine-1-carbothioamide.
| Compound Name | 4-(5-chloro-2-methylphenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 46247979 |
| Molecular Formula | C28H35ClN6S |
| Molecular Weight | 523.15 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 4-(5-chloro-2-methylphenyl)-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]piperazine-1-carbothioamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)N4CCN(c5cc(Cl)ccc5C)CC4)ccc3n2)CC1 |
| InChI | InChI=1S/C28H35ClN6S/c1-4-32-9-11-34(12-10-32)27-17-21(3)24-19-23(7-8-25(24)31-27)30-28(36)35-15-13-33(14-16-35)26-18-22(29)6-5-20(26)2/h5-8,17-19H,4,9-16H2,1-3H3,(H,30,36) |
| InChIKey | RAKFUIXZLQTFTQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 37.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.15 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|