C29H36N4O — CID 22421737
2-cyclopentyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-phenylacetamide (PubChem CID 22421737) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-phenylacetamide.
| Compound Name | 2-cyclopentyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 22421737 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 2-cyclopentyl-N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-phenylacetamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)C(c4ccccc4)C4CCCC4)ccc3n2)CC1 |
| InChI | InChI=1S/C29H36N4O/c1-3-32-15-17-33(18-16-32)27-19-21(2)25-20-24(13-14-26(25)31-27)30-29(34)28(23-11-7-8-12-23)22-9-5-4-6-10-22/h4-6,9-10,13-14,19-20,23,28H,3,7-8,11-12,15-18H2,1-2H3,(H,30,34) |
| InChIKey | XUXJPBMTZZLRHL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |