C32H44N6S — CID 46247991
1-[3-(4-benzylpiperidin-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea (PubChem CID 46247991) has the molecular formula C32H44N6S and a molecular weight of 544.81 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperidin-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea.
| Compound Name | 1-[3-(4-benzylpiperidin-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 46247991 |
| Molecular Formula | C32H44N6S |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | 1-[3-(4-benzylpiperidin-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)NCCCN4CCC(Cc5ccccc5)CC4)ccc3n2)CC1 |
| InChI | InChI=1S/C32H44N6S/c1-3-36-18-20-38(21-19-36)31-22-25(2)29-24-28(10-11-30(29)35-31)34-32(39)33-14-7-15-37-16-12-27(13-17-37)23-26-8-5-4-6-9-26/h4-6,8-11,22,24,27H,3,7,12-21,23H2,1-2H3,(H2,33,34,39) |
| InChIKey | JXARWEMMHOLSGS-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|