C27H36N6S — CID 46247996
1-[2-[benzyl(methyl)amino]ethyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea (PubChem CID 46247996) has the molecular formula C27H36N6S and a molecular weight of 476.69 g/mol. Its IUPAC name is 1-[2-[benzyl(methyl)amino]ethyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea.
| Compound Name | 1-[2-[benzyl(methyl)amino]ethyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 46247996 |
| Molecular Formula | C27H36N6S |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 1-[2-[benzyl(methyl)amino]ethyl]-3-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]thiourea |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=S)NCCN(C)Cc4ccccc4)ccc3n2)CC1 |
| InChI | InChI=1S/C27H36N6S/c1-4-32-14-16-33(17-15-32)26-18-21(2)24-19-23(10-11-25(24)30-26)29-27(34)28-12-13-31(3)20-22-8-6-5-7-9-22/h5-11,18-19H,4,12-17,20H2,1-3H3,(H2,28,29,34) |
| InChIKey | FBONWBMLAZMRQS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|