C28H36N6S — CID 45489314
1-(1-benzylpiperidin-4-yl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea (PubChem CID 45489314) has the molecular formula C28H36N6S and a molecular weight of 488.71 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 45489314 |
| Molecular Formula | C28H36N6S |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea |
| SMILES | Cc1cc(N2CCN(C)CC2)nc2ccc(NC(=S)NC3CCN(Cc4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C28H36N6S/c1-21-18-27(34-16-14-32(2)15-17-34)31-26-9-8-24(19-25(21)26)30-28(35)29-23-10-12-33(13-11-23)20-22-6-4-3-5-7-22/h3-9,18-19,23H,10-17,20H2,1-2H3,(H2,29,30,35) |
| InChIKey | UMJGJNMSNVPBIT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|