C28H37N5O2S — CID 46248019
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea (PubChem CID 46248019) has the molecular formula C28H37N5O2S and a molecular weight of 507.70 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea.
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 46248019 |
| Molecular Formula | C28H37N5O2S |
| Molecular Weight | 507.70 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[4-methyl-2-(4-methylpiperazin-1-yl)quinolin-6-yl]thiourea |
| SMILES | CCOc1ccc(CCNC(=S)Nc2ccc3nc(N4CCN(C)CC4)cc(C)c3c2)cc1OCC |
| InChI | InChI=1S/C28H37N5O2S/c1-5-34-25-10-7-21(18-26(25)35-6-2)11-12-29-28(36)30-22-8-9-24-23(19-22)20(3)17-27(31-24)33-15-13-32(4)14-16-33/h7-10,17-19H,5-6,11-16H2,1-4H3,(H2,29,30,36) |
| InChIKey | HISINWPIEKKBQO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|