C28H36N6O — CID 73389427
2-[(1-benzylpiperidin-4-yl)amino]-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide (PubChem CID 73389427) has the molecular formula C28H36N6O and a molecular weight of 472.64 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)amino]-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 73389427 |
| Molecular Formula | C28H36N6O |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)amino]-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide |
| SMILES | Cc1cc(N2CCNCC2)nc2ccc(NC(=O)CNC3CCN(Cc4ccccc4)CC3)cc12 |
| InChI | InChI=1S/C28H36N6O/c1-21-17-27(34-15-11-29-12-16-34)32-26-8-7-24(18-25(21)26)31-28(35)19-30-23-9-13-33(14-10-23)20-22-5-3-2-4-6-22/h2-8,17-18,23,29-30H,9-16,19-20H2,1H3,(H,31,35) |
| InChIKey | PQSWAEWZAQVQHE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |