C39H47N7O7S — CID 144582887
tert-butyl 4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazine-1-carboxylate (PubChem CID 144582887) has the molecular formula C39H47N7O7S and a molecular weight of 757.91 g/mol. Its IUPAC name is tert-butyl 4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 144582887 |
| Molecular Formula | C39H47N7O7S |
| Molecular Weight | 757.91 g/mol |
| Exact Mass | 757.33 |
| IUPAC Name | tert-butyl 4-[6-[[2-[(1-benzylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetyl]amino]-4-methylquinolin-2-yl]piperazine-1-carboxylate |
| SMILES | Cc1cc(N2CCN(C(=O)OC(C)(C)C)CC2)nc2ccc(NC(=O)CN(C3CCN(Cc4ccccc4)CC3)S(=O)(=O)c3ccccc3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C39H47N7O7S/c1-28-24-36(43-20-22-44(23-21-43)38(48)53-39(2,3)4)41-33-15-14-30(25-32(28)33)40-37(47)27-45(54(51,52)35-13-9-8-12-34(35)46(49)50)31-16-18-42(19-17-31)26-29-10-6-5-7-11-29/h5-15,24-25,31H,16-23,26-27H2,1-4H3,(H,40,47) |
| InChIKey | UZXJQHVUXMSXMY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 158.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.91 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|